C13H18N4 — CID 97170573
3-[[(2R)-piperidin-2-yl]methyl]-4H-1,2,3-benzotriazine (PubChem CID 97170573) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[[(2R)-piperidin-2-yl]methyl]-4H-1,2,3-benzotriazine.
| Compound Name | 3-[[(2R)-piperidin-2-yl]methyl]-4H-1,2,3-benzotriazine |
|---|---|
| PubChem CID | 97170573 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-[[(2R)-piperidin-2-yl]methyl]-4H-1,2,3-benzotriazine |
| SMILES | c1ccc2c(c1)CN(C[C@H]1CCCCN1)N=N2 |
| InChI | InChI=1S/C13H18N4/c1-2-7-13-11(5-1)9-17(16-15-13)10-12-6-3-4-8-14-12/h1-2,5,7,12,14H,3-4,6,8-10H2/t12-/m1/s1 |
| InChIKey | SQGVFHBOOGCMJA-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |