C13H17N3S — CID 97169874
3-[[(2S)-pyrrolidin-2-yl]methyl]-1,4-dihydroquinazoline-2-thione (PubChem CID 97169874) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 3-[[(2S)-pyrrolidin-2-yl]methyl]-1,4-dihydroquinazoline-2-thione.
| Compound Name | 3-[[(2S)-pyrrolidin-2-yl]methyl]-1,4-dihydroquinazoline-2-thione |
|---|---|
| PubChem CID | 97169874 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-[[(2S)-pyrrolidin-2-yl]methyl]-1,4-dihydroquinazoline-2-thione |
| SMILES | S=C1Nc2ccccc2CN1C[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H17N3S/c17-13-15-12-6-2-1-4-10(12)8-16(13)9-11-5-3-7-14-11/h1-2,4,6,11,14H,3,5,7-9H2,(H,15,17)/t11-/m0/s1 |
| InChIKey | NJQIZMPHHTVXHB-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|