C9H15F3N2O — CID 97170906
N-[[(2R)-1-(trifluoromethyl)piperidin-2-yl]methyl]acetamide (PubChem CID 97170906) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is N-[[(2R)-1-(trifluoromethyl)piperidin-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R)-1-(trifluoromethyl)piperidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97170906 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[[(2R)-1-(trifluoromethyl)piperidin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CCCCN1C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-7(15)13-6-8-4-2-3-5-14(8)9(10,11)12/h8H,2-6H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | AYGOBGBQEBOUFF-MRVPVSSYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|