C16H27N5O2S — CID 97188368
(3S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-1-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 97188368) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is (3S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-1-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97188368 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (3S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | Nc1nnc(CCCNC(=O)[C@H]2CCCN(C3CCOCC3)C2)s1 |
| InChI | InChI=1S/C16H27N5O2S/c17-16-20-19-14(24-16)4-1-7-18-15(22)12-3-2-8-21(11-12)13-5-9-23-10-6-13/h12-13H,1-11H2,(H2,17,20)(H,18,22)/t12-/m0/s1 |
| InChIKey | VRDCQOZVUULSMG-LBPRGKRZSA-N |
| XLogP | 1.06 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|