C17H19N3O3S2 — CID 97188968
N-(pyridin-3-ylmethyl)-3-[[(3R)-thiolan-3-yl]sulfamoyl]benzamide (PubChem CID 97188968) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-3-[[(3R)-thiolan-3-yl]sulfamoyl]benzamide.
| Compound Name | N-(pyridin-3-ylmethyl)-3-[[(3R)-thiolan-3-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 97188968 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-3-[[(3R)-thiolan-3-yl]sulfamoyl]benzamide |
| SMILES | O=C(NCc1cccnc1)c1cccc(S(=O)(=O)N[C@@H]2CCSC2)c1 |
| InChI | InChI=1S/C17H19N3O3S2/c21-17(19-11-13-3-2-7-18-10-13)14-4-1-5-16(9-14)25(22,23)20-15-6-8-24-12-15/h1-5,7,9-10,15,20H,6,8,11-12H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | URANAWGRNMQCEG-OAHLLOKOSA-N |
| XLogP | 1.80 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |