C17H25N5O — CID 97189429
(3R)-1-[3-[(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol (PubChem CID 97189429) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R)-1-[3-[(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol.
| Compound Name | (3R)-1-[3-[(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol |
|---|---|
| PubChem CID | 97189429 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (3R)-1-[3-[(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol |
| SMILES | Cc1cc(C)c2c(NCCCN3CCC[C@@H](O)C3)ncnc2n1 |
| InChI | InChI=1S/C17H25N5O/c1-12-9-13(2)21-17-15(12)16(19-11-20-17)18-6-4-8-22-7-3-5-14(23)10-22/h9,11,14,23H,3-8,10H2,1-2H3,(H,18,19,20,21)/t14-/m1/s1 |
| InChIKey | GBXXGLXFIHPBNJ-CQSZACIVSA-N |
| XLogP | 1.90 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|