C18H27N5O — CID 72895054
N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 72895054) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72895054 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COCCCN1CCC(CNc2ncnc3nc(C)cc(C)c23)C1 |
| InChI | InChI=1S/C18H27N5O/c1-13-9-14(2)22-18-16(13)17(20-12-21-18)19-10-15-5-7-23(11-15)6-4-8-24-3/h9,12,15H,4-8,10-11H2,1-3H3,(H,19,20,21,22) |
| InChIKey | JCFJMQKDFPUENB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|