C17H28N4O2 — CID 97456473
1-(2,6-dimethyl-3-pyridinyl)-3-[[(3S)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 97456473) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)-3-[[(3S)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)-3-[[(3S)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 97456473 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)-3-[[(3S)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COCCCN1CC[C@@H](CNC(=O)Nc2ccc(C)nc2C)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-13-5-6-16(14(2)19-13)20-17(22)18-11-15-7-9-21(12-15)8-4-10-23-3/h5-6,15H,4,7-12H2,1-3H3,(H2,18,20,22)/t15-/m0/s1 |
| InChIKey | OYPBLNUZMIXNSQ-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|