C17H24N4O2S — CID 97437618
1-(1,3-benzothiazol-5-yl)-3-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 97437618) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-5-yl)-3-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-5-yl)-3-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 97437618 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(1,3-benzothiazol-5-yl)-3-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COCCCN1CC[C@H](CNC(=O)Nc2ccc3scnc3c2)C1 |
| InChI | InChI=1S/C17H24N4O2S/c1-23-8-2-6-21-7-5-13(11-21)10-18-17(22)20-14-3-4-16-15(9-14)19-12-24-16/h3-4,9,12-13H,2,5-8,10-11H2,1H3,(H2,18,20,22)/t13-/m1/s1 |
| InChIKey | LXHIQZJCPRRROK-CYBMUJFWSA-N |
| XLogP | 2.78 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|