C16H24N6O2 — CID 97456895
1-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-8-yl)urea (PubChem CID 97456895) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-8-yl)urea.
| Compound Name | 1-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 97456895 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-[[(3R)-1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-8-yl)urea |
| SMILES | COCCCN1CC[C@H](CNC(=O)Nc2cccn3cnnc23)C1 |
| InChI | InChI=1S/C16H24N6O2/c1-24-9-3-6-21-8-5-13(11-21)10-17-16(23)19-14-4-2-7-22-12-18-20-15(14)22/h2,4,7,12-13H,3,5-6,8-11H2,1H3,(H2,17,19,23)/t13-/m1/s1 |
| InChIKey | QVXDXBYQWRAHRH-CYBMUJFWSA-N |
| XLogP | 1.21 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|