C17H23FN2O4 — CID 97191658
(2R)-2-(4-carbamoylpiperidin-1-yl)-2-(2-fluoro-6-propan-2-yloxyphenyl)acetic acid (PubChem CID 97191658) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is (2R)-2-(4-carbamoylpiperidin-1-yl)-2-(2-fluoro-6-propan-2-yloxyphenyl)acetic acid.
| Compound Name | (2R)-2-(4-carbamoylpiperidin-1-yl)-2-(2-fluoro-6-propan-2-yloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 97191658 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2R)-2-(4-carbamoylpiperidin-1-yl)-2-(2-fluoro-6-propan-2-yloxyphenyl)acetic acid |
| SMILES | CC(C)Oc1cccc(F)c1[C@H](C(=O)O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H23FN2O4/c1-10(2)24-13-5-3-4-12(18)14(13)15(17(22)23)20-8-6-11(7-9-20)16(19)21/h3-5,10-11,15H,6-9H2,1-2H3,(H2,19,21)(H,22,23)/t15-/m1/s1 |
| InChIKey | RYNZWNMLXATDEX-OAHLLOKOSA-N |
| XLogP | 1.94 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |