C18H18ClN3O2 — CID 97197584
(2R)-3-(4-chlorophenyl)-2-[[2-(hydroxymethyl)quinazolin-4-yl]amino]propan-1-ol (PubChem CID 97197584) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is (2R)-3-(4-chlorophenyl)-2-[[2-(hydroxymethyl)quinazolin-4-yl]amino]propan-1-ol.
| Compound Name | (2R)-3-(4-chlorophenyl)-2-[[2-(hydroxymethyl)quinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 97197584 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2R)-3-(4-chlorophenyl)-2-[[2-(hydroxymethyl)quinazolin-4-yl]amino]propan-1-ol |
| SMILES | OCc1nc(N[C@@H](CO)Cc2ccc(Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-13-7-5-12(6-8-13)9-14(10-23)20-18-15-3-1-2-4-16(15)21-17(11-24)22-18/h1-8,14,23-24H,9-11H2,(H,20,21,22)/t14-/m1/s1 |
| InChIKey | SBODCZYIMVNEAH-CQSZACIVSA-N |
| XLogP | 2.79 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |