C18H24FN3O4 — CID 97198544
(3R)-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide (PubChem CID 97198544) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is (3R)-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97198544 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (3R)-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide |
| SMILES | COCC(=O)N1CCC[C@@H](C(=O)NCCNC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H24FN3O4/c1-26-12-16(23)22-10-2-3-14(11-22)18(25)21-9-8-20-17(24)13-4-6-15(19)7-5-13/h4-7,14H,2-3,8-12H2,1H3,(H,20,24)(H,21,25)/t14-/m1/s1 |
| InChIKey | WXJWQYYEHAVNIG-CQSZACIVSA-N |
| XLogP | 0.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|