C16H20ClFN2O3 — CID 72924717
N-[(3-chloro-4-fluorophenyl)methyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide (PubChem CID 72924717) has the molecular formula C16H20ClFN2O3 and a molecular weight of 342.80 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72924717 |
| Molecular Formula | C16H20ClFN2O3 |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-(2-methoxyacetyl)piperidine-3-carboxamide |
| SMILES | COCC(=O)N1CCCC(C(=O)NCc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20ClFN2O3/c1-23-10-15(21)20-6-2-3-12(9-20)16(22)19-8-11-4-5-14(18)13(17)7-11/h4-5,7,12H,2-3,6,8-10H2,1H3,(H,19,22) |
| InChIKey | NKIWWWWZICYYBA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |