C16H26N2O3 — CID 97274269
(3R)-N-(cyclohexen-1-ylmethyl)-1-(2-methoxyacetyl)piperidine-3-carboxamide (PubChem CID 97274269) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3R)-N-(cyclohexen-1-ylmethyl)-1-(2-methoxyacetyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(cyclohexen-1-ylmethyl)-1-(2-methoxyacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97274269 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3R)-N-(cyclohexen-1-ylmethyl)-1-(2-methoxyacetyl)piperidine-3-carboxamide |
| SMILES | COCC(=O)N1CCC[C@@H](C(=O)NCC2=CCCCC2)C1 |
| InChI | InChI=1S/C16H26N2O3/c1-21-12-15(19)18-9-5-8-14(11-18)16(20)17-10-13-6-3-2-4-7-13/h6,14H,2-5,7-12H2,1H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | YGPYQDCJWFEUOR-CQSZACIVSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|