C16H22ClNO4 — CID 97204833
(2S)-2-(5-chloro-2-ethoxyphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]acetic acid (PubChem CID 97204833) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2-ethoxyphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]acetic acid.
| Compound Name | (2S)-2-(5-chloro-2-ethoxyphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97204833 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2S)-2-(5-chloro-2-ethoxyphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]acetic acid |
| SMILES | CCOc1ccc(Cl)cc1[C@@H](C(=O)O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C16H22ClNO4/c1-2-22-14-4-3-12(17)9-13(14)15(16(20)21)18-7-5-11(10-19)6-8-18/h3-4,9,11,15,19H,2,5-8,10H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | WIULXHJEYZDVEP-HNNXBMFYSA-N |
| XLogP | 2.57 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |