C17H27ClN2O2 — CID 83974682
2-[4-[2-amino-1-(5-chloro-2-ethoxyphenyl)ethyl]piperidin-1-yl]ethanol (PubChem CID 83974682) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-[4-[2-amino-1-(5-chloro-2-ethoxyphenyl)ethyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[2-amino-1-(5-chloro-2-ethoxyphenyl)ethyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 83974682 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-[4-[2-amino-1-(5-chloro-2-ethoxyphenyl)ethyl]piperidin-1-yl]ethanol |
| SMILES | CCOc1ccc(Cl)cc1C(CN)C1CCN(CCO)CC1 |
| InChI | InChI=1S/C17H27ClN2O2/c1-2-22-17-4-3-14(18)11-15(17)16(12-19)13-5-7-20(8-6-13)9-10-21/h3-4,11,13,16,21H,2,5-10,12,19H2,1H3 |
| InChIKey | RHPMIELJGIYQTB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |