C19H31ClN2O — CID 83974680
2-(5-chloro-2-ethoxyphenyl)-2-[1-(2-methylpropyl)piperidin-4-yl]ethanamine (PubChem CID 83974680) has the molecular formula C19H31ClN2O and a molecular weight of 338.92 g/mol. Its IUPAC name is 2-(5-chloro-2-ethoxyphenyl)-2-[1-(2-methylpropyl)piperidin-4-yl]ethanamine.
| Compound Name | 2-(5-chloro-2-ethoxyphenyl)-2-[1-(2-methylpropyl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 83974680 |
| Molecular Formula | C19H31ClN2O |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-(5-chloro-2-ethoxyphenyl)-2-[1-(2-methylpropyl)piperidin-4-yl]ethanamine |
| SMILES | CCOc1ccc(Cl)cc1C(CN)C1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C19H31ClN2O/c1-4-23-19-6-5-16(20)11-17(19)18(12-21)15-7-9-22(10-8-15)13-14(2)3/h5-6,11,14-15,18H,4,7-10,12-13,21H2,1-3H3 |
| InChIKey | YBLQDXSNOKPOBW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |