C19H31NOS — CID 83974980
2-(5-tert-butyl-2-ethoxyphenyl)-2-(thian-4-yl)ethanamine (PubChem CID 83974980) has the molecular formula C19H31NOS and a molecular weight of 321.53 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-ethoxyphenyl)-2-(thian-4-yl)ethanamine.
| Compound Name | 2-(5-tert-butyl-2-ethoxyphenyl)-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 83974980 |
| Molecular Formula | C19H31NOS |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-(5-tert-butyl-2-ethoxyphenyl)-2-(thian-4-yl)ethanamine |
| SMILES | CCOc1ccc(C(C)(C)C)cc1C(CN)C1CCSCC1 |
| InChI | InChI=1S/C19H31NOS/c1-5-21-18-7-6-15(19(2,3)4)12-16(18)17(13-20)14-8-10-22-11-9-14/h6-7,12,14,17H,5,8-11,13,20H2,1-4H3 |
| InChIKey | LRTNKYQVAPLWGZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |