C18H29FN2O — CID 83974722
2-(2-ethoxy-5-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethanamine (PubChem CID 83974722) has the molecular formula C18H29FN2O and a molecular weight of 308.44 g/mol. Its IUPAC name is 2-(2-ethoxy-5-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethanamine.
| Compound Name | 2-(2-ethoxy-5-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 83974722 |
| Molecular Formula | C18H29FN2O |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-(2-ethoxy-5-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethanamine |
| SMILES | CCOc1ccc(F)cc1C(CN)C1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C18H29FN2O/c1-4-22-18-6-5-15(19)11-16(18)17(12-20)14-7-9-21(10-8-14)13(2)3/h5-6,11,13-14,17H,4,7-10,12,20H2,1-3H3 |
| InChIKey | XNWYSEDUPIKJRQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |