C15H16N4O4S — CID 97211593
2-[(2S)-1-(2,4-dinitrophenyl)piperidin-2-yl]-4-methyl-1,3-thiazole (PubChem CID 97211593) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-[(2S)-1-(2,4-dinitrophenyl)piperidin-2-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2S)-1-(2,4-dinitrophenyl)piperidin-2-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 97211593 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[(2S)-1-(2,4-dinitrophenyl)piperidin-2-yl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc([C@@H]2CCCCN2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H16N4O4S/c1-10-9-24-15(16-10)13-4-2-3-7-17(13)12-6-5-11(18(20)21)8-14(12)19(22)23/h5-6,8-9,13H,2-4,7H2,1H3/t13-/m0/s1 |
| InChIKey | TUAXOWODKBFQPB-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|