C18H16BrN5O3 — CID 97212220
3-[(4-bromophenyl)methyl]-5-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 97212220) has the molecular formula C18H16BrN5O3 and a molecular weight of 430.26 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-5-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[(4-bromophenyl)methyl]-5-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97212220 |
| Molecular Formula | C18H16BrN5O3 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-5-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccnc1N1CCC[C@@H]1c1nc(Cc2ccc(Br)cc2)no1 |
| InChI | InChI=1S/C18H16BrN5O3/c19-13-7-5-12(6-8-13)11-16-21-18(27-22-16)15-4-2-10-23(15)17-14(24(25)26)3-1-9-20-17/h1,3,5-9,15H,2,4,10-11H2/t15-/m1/s1 |
| InChIKey | BUQACNMTEZJKTR-OAHLLOKOSA-N |
| XLogP | 4.07 |
| TPSA | 98.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|