C18H23N3O2S — CID 97215996
(2S)-4-benzyl-N-[3-(1,3-thiazol-2-yl)propyl]morpholine-2-carboxamide (PubChem CID 97215996) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is (2S)-4-benzyl-N-[3-(1,3-thiazol-2-yl)propyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-benzyl-N-[3-(1,3-thiazol-2-yl)propyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 97215996 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (2S)-4-benzyl-N-[3-(1,3-thiazol-2-yl)propyl]morpholine-2-carboxamide |
| SMILES | O=C(NCCCc1nccs1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C18H23N3O2S/c22-18(20-8-4-7-17-19-9-12-24-17)16-14-21(10-11-23-16)13-15-5-2-1-3-6-15/h1-3,5-6,9,12,16H,4,7-8,10-11,13-14H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | GACHTXJVRAWMIV-INIZCTEOSA-N |
| XLogP | 2.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|