C21H28FN3O4 — CID 97219686
tert-butyl N-[[(5R,6R)-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate (PubChem CID 97219686) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is tert-butyl N-[[(5R,6R)-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(5R,6R)-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 97219686 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[[(5R,6R)-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCCC[C@@]12NC(=O)N(Cc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C21H28FN3O4/c1-20(2,3)29-19(28)23-12-15-8-4-5-10-21(15)17(26)25(18(27)24-21)13-14-7-6-9-16(22)11-14/h6-7,9,11,15H,4-5,8,10,12-13H2,1-3H3,(H,23,28)(H,24,27)/t15-,21-/m1/s1 |
| InChIKey | QVLADQDXUGMXDM-QVKFZJNVSA-N |
| XLogP | 3.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|