C22H27N5O — CID 97221613
(4,6-dimethyl-1H-indol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 97221613) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is (4,6-dimethyl-1H-indol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4,6-dimethyl-1H-indol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97221613 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (4,6-dimethyl-1H-indol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C)c2cc(C(=O)N3CCCC[C@@H]3c3nnc4n3CCCC4)[nH]c2c1 |
| InChI | InChI=1S/C22H27N5O/c1-14-11-15(2)16-13-18(23-17(16)12-14)22(28)26-9-5-3-7-19(26)21-25-24-20-8-4-6-10-27(20)21/h11-13,19,23H,3-10H2,1-2H3/t19-/m1/s1 |
| InChIKey | GPASFAPHKZAEFY-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |