C18H24ClN3O2 — CID 97223703
1-[(4-chloro-1-methylpyrrol-2-yl)methyl]-3-[(2S)-2-(2-methoxyphenyl)propyl]-1-methylurea (PubChem CID 97223703) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 1-[(4-chloro-1-methylpyrrol-2-yl)methyl]-3-[(2S)-2-(2-methoxyphenyl)propyl]-1-methylurea.
| Compound Name | 1-[(4-chloro-1-methylpyrrol-2-yl)methyl]-3-[(2S)-2-(2-methoxyphenyl)propyl]-1-methylurea |
|---|---|
| PubChem CID | 97223703 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[(4-chloro-1-methylpyrrol-2-yl)methyl]-3-[(2S)-2-(2-methoxyphenyl)propyl]-1-methylurea |
| SMILES | COc1ccccc1[C@H](C)CNC(=O)N(C)Cc1cc(Cl)cn1C |
| InChI | InChI=1S/C18H24ClN3O2/c1-13(16-7-5-6-8-17(16)24-4)10-20-18(23)22(3)12-15-9-14(19)11-21(15)2/h5-9,11,13H,10,12H2,1-4H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | FKIQAQCUZFNKDW-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |