About 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide
4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide (PubChem CID 97230033) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide |
| PubChem CID | 97230033 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide |
| SMILES | COc1ccc([C@@H](C)[C@@H](C)NCC2(C(N)=O)CCOCC2)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-13(15-4-6-16(22-3)7-5-15)14(2)20-12-18(17(19)21)8-10-23-11-9-18/h4-7,13-14,20H,8-12H2,1-3H3,(H2,19,21)/t13-,14+/m0/s1 |
| InChIKey | YBHHQYDNVRTGEF-UONOGXRCSA-N |
| XLogP | 2.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide?
The IUPAC name of 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide (CID 97230033) is 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide.
What is the SMILES notation for 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide?
The canonical SMILES for 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide is COc1ccc([C@@H](C)[C@@H](C)NCC2(C(N)=O)CCOCC2)cc1.
What is the InChIKey of 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide?
The InChIKey is YBHHQYDNVRTGEF-UONOGXRCSA-N. The full InChI is InChI=1S/C18H28N2O3/c1-13(15-4-6-16(22-3)7-5-15)14(2)20-12-18(17(19)21)8-10-23-11-9-18/h4-7,13-14,20H,8-12H2,1-3H3,(H2,19,21)/t13-,14+/m0/s1.
What are the key properties of 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide?
4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide has a molecular weight of 320.43 g/mol, XLogP of 2.06, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(2R,3R)-3-(4-methoxyphenyl)butan-2-yl]amino]methyl]oxane-4-carboxamide is sourced from PubChem (CID 97230033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).