C19H19FN2 — CID 97231657
4-[[[(1S)-1-cyclopropyl-2-phenylethyl]amino]methyl]-3-fluorobenzonitrile (PubChem CID 97231657) has the molecular formula C19H19FN2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-[[[(1S)-1-cyclopropyl-2-phenylethyl]amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[[(1S)-1-cyclopropyl-2-phenylethyl]amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 97231657 |
| Molecular Formula | C19H19FN2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-[[[(1S)-1-cyclopropyl-2-phenylethyl]amino]methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CN[C@@H](Cc2ccccc2)C2CC2)c(F)c1 |
| InChI | InChI=1S/C19H19FN2/c20-18-10-15(12-21)6-7-17(18)13-22-19(16-8-9-16)11-14-4-2-1-3-5-14/h1-7,10,16,19,22H,8-9,11,13H2/t19-/m0/s1 |
| InChIKey | JXRWAKCZQVNKGP-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |