C21H30N4OS — CID 97233486
(5S)-5-tert-butyl-N-[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 97233486) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is (5S)-5-tert-butyl-N-[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-tert-butyl-N-[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 97233486 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (5S)-5-tert-butyl-N-[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc2c(s1)CC[C@H](C(C)(C)C)C2)c1nnc2n1CCCC2 |
| InChI | InChI=1S/C21H30N4OS/c1-13(19-24-23-18-7-5-6-10-25(18)19)22-20(26)17-12-14-11-15(21(2,3)4)8-9-16(14)27-17/h12-13,15H,5-11H2,1-4H3,(H,22,26)/t13-,15-/m0/s1 |
| InChIKey | BEJWICAKQSCTPF-ZFWWWQNUSA-N |
| XLogP | 4.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |