C17H30N2O2S — CID 97234883
1-cyclooctyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea (PubChem CID 97234883) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-cyclooctyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-cyclooctyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 97234883 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-cyclooctyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea |
| SMILES | O=C(NC1CCCCCCC1)N[C@H]1CCO[C@]2(CCSC2)C1 |
| InChI | InChI=1S/C17H30N2O2S/c20-16(18-14-6-4-2-1-3-5-7-14)19-15-8-10-21-17(12-15)9-11-22-13-17/h14-15H,1-13H2,(H2,18,19,20)/t15-,17+/m0/s1 |
| InChIKey | HHNDLIVBDZUEHS-DOTOQJQBSA-N |
| XLogP | 3.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |