C19H26N2O2S — CID 97235550
1-[(5R,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-3-(1-phenylcyclobutyl)urea (PubChem CID 97235550) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(5R,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-3-(1-phenylcyclobutyl)urea.
| Compound Name | 1-[(5R,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-3-(1-phenylcyclobutyl)urea |
|---|---|
| PubChem CID | 97235550 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(5R,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-3-(1-phenylcyclobutyl)urea |
| SMILES | O=C(N[C@@H]1CCO[C@@]2(CCSC2)C1)NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C19H26N2O2S/c22-17(20-16-7-11-23-18(13-16)10-12-24-14-18)21-19(8-4-9-19)15-5-2-1-3-6-15/h1-3,5-6,16H,4,7-14H2,(H2,20,21,22)/t16-,18+/m1/s1 |
| InChIKey | LHCPYAHMYNNFBK-AEFFLSMTSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |