C17H20N2O2S — CID 99601505
N-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-1H-indole-6-carboxamide (PubChem CID 99601505) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-1H-indole-6-carboxamide.
| Compound Name | N-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 99601505 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]-1H-indole-6-carboxamide |
| SMILES | O=C(N[C@H]1CCO[C@]2(CCSC2)C1)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C17H20N2O2S/c20-16(13-2-1-12-3-6-18-15(12)9-13)19-14-4-7-21-17(10-14)5-8-22-11-17/h1-3,6,9,14,18H,4-5,7-8,10-11H2,(H,19,20)/t14-,17+/m0/s1 |
| InChIKey | CBQNONCNEPYESJ-WMLDXEAASA-N |
| XLogP | 2.95 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |