C16H28N2O2S — CID 97235483
1-cycloheptyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea (PubChem CID 97235483) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-cycloheptyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-cycloheptyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 97235483 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-cycloheptyl-3-[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]urea |
| SMILES | O=C(NC1CCCCCC1)N[C@H]1CCO[C@]2(CCSC2)C1 |
| InChI | InChI=1S/C16H28N2O2S/c19-15(17-13-5-3-1-2-4-6-13)18-14-7-9-20-16(11-14)8-10-21-12-16/h13-14H,1-12H2,(H2,17,18,19)/t14-,16+/m0/s1 |
| InChIKey | VVSVMOWNXVDSFO-GOEBONIOSA-N |
| XLogP | 3.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |