C9H16F3NO2 — CID 97236930
4,4,4-trifluoro-N-[(2R)-2-hydroxy-3-methylbutyl]butanamide (PubChem CID 97236930) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(2R)-2-hydroxy-3-methylbutyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(2R)-2-hydroxy-3-methylbutyl]butanamide |
|---|---|
| PubChem CID | 97236930 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[(2R)-2-hydroxy-3-methylbutyl]butanamide |
| SMILES | CC(C)[C@@H](O)CNC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-6(2)7(14)5-13-8(15)3-4-9(10,11)12/h6-7,14H,3-5H2,1-2H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | MMULSGJKOCBTBC-ZETCQYMHSA-N |
| XLogP | 1.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |