C13H16F3NO3 — CID 97240682
2-[(2S)-butan-2-yl]oxy-N-[4-hydroxy-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 97240682) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[(2S)-butan-2-yl]oxy-N-[4-hydroxy-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2S)-butan-2-yl]oxy-N-[4-hydroxy-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 97240682 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(2S)-butan-2-yl]oxy-N-[4-hydroxy-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC[C@H](C)OCC(=O)Nc1ccc(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-3-8(2)20-7-12(19)17-9-4-5-11(18)10(6-9)13(14,15)16/h4-6,8,18H,3,7H2,1-2H3,(H,17,19)/t8-/m0/s1 |
| InChIKey | XOUOCQAKDKARIE-QMMMGPOBSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|