C21H19BrN2O3 — CID 97246650
[2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 3-aminonaphthalene-1-carboxylate (PubChem CID 97246650) has the molecular formula C21H19BrN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 3-aminonaphthalene-1-carboxylate.
| Compound Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 3-aminonaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 97246650 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 3-aminonaphthalene-1-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cc(N)cc2ccccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O3/c1-13(14-6-8-16(22)9-7-14)24-20(25)12-27-21(26)19-11-17(23)10-15-4-2-3-5-18(15)19/h2-11,13H,12,23H2,1H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | LHTRIDIHSSOUME-ZDUSSCGKSA-N |
| XLogP | 4.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|