C11H19NO3S — CID 97246767
methyl (3S)-3-[[(2S)-2-methylbutanoyl]amino]thiolane-3-carboxylate (PubChem CID 97246767) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is methyl (3S)-3-[[(2S)-2-methylbutanoyl]amino]thiolane-3-carboxylate.
| Compound Name | methyl (3S)-3-[[(2S)-2-methylbutanoyl]amino]thiolane-3-carboxylate |
|---|---|
| PubChem CID | 97246767 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl (3S)-3-[[(2S)-2-methylbutanoyl]amino]thiolane-3-carboxylate |
| SMILES | CC[C@H](C)C(=O)N[C@]1(C(=O)OC)CCSC1 |
| InChI | InChI=1S/C11H19NO3S/c1-4-8(2)9(13)12-11(10(14)15-3)5-6-16-7-11/h8H,4-7H2,1-3H3,(H,12,13)/t8-,11+/m0/s1 |
| InChIKey | JMPFGYHPOJUCDQ-GZMMTYOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |