C18H26N2O5S2 — CID 97095748
methyl 4-[[4-[[(2S)-butan-2-yl]sulfamoyl]benzoyl]amino]thiane-4-carboxylate (PubChem CID 97095748) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl 4-[[4-[[(2S)-butan-2-yl]sulfamoyl]benzoyl]amino]thiane-4-carboxylate.
| Compound Name | methyl 4-[[4-[[(2S)-butan-2-yl]sulfamoyl]benzoyl]amino]thiane-4-carboxylate |
|---|---|
| PubChem CID | 97095748 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl 4-[[4-[[(2S)-butan-2-yl]sulfamoyl]benzoyl]amino]thiane-4-carboxylate |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc(C(=O)NC2(C(=O)OC)CCSCC2)cc1 |
| InChI | InChI=1S/C18H26N2O5S2/c1-4-13(2)20-27(23,24)15-7-5-14(6-8-15)16(21)19-18(17(22)25-3)9-11-26-12-10-18/h5-8,13,20H,4,9-12H2,1-3H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | KRJVVQQQQJWMPC-ZDUSSCGKSA-N |
| XLogP | 1.93 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |