C17H27NO5S — CID 97246800
N-[(1S,2S)-1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]-2-pentylsulfonylacetamide (PubChem CID 97246800) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is N-[(1S,2S)-1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]-2-pentylsulfonylacetamide.
| Compound Name | N-[(1S,2S)-1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]-2-pentylsulfonylacetamide |
|---|---|
| PubChem CID | 97246800 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[(1S,2S)-1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]-2-pentylsulfonylacetamide |
| SMILES | CCCCCS(=O)(=O)CC(=O)N[C@@H](C)[C@@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H27NO5S/c1-4-5-6-11-24(21,22)12-16(19)18-13(2)17(20)14-7-9-15(23-3)10-8-14/h7-10,13,17,20H,4-6,11-12H2,1-3H3,(H,18,19)/t13-,17+/m0/s1 |
| InChIKey | AYZLHBPVCYKJKH-SUMWQHHRSA-N |
| XLogP | 1.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|