C20H17ClN4O — CID 97248176
2-[(2S)-1-(7-chloroquinazolin-4-yl)piperidin-2-yl]-1,3-benzoxazole (PubChem CID 97248176) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is 2-[(2S)-1-(7-chloroquinazolin-4-yl)piperidin-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[(2S)-1-(7-chloroquinazolin-4-yl)piperidin-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 97248176 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[(2S)-1-(7-chloroquinazolin-4-yl)piperidin-2-yl]-1,3-benzoxazole |
| SMILES | Clc1ccc2c(N3CCCC[C@H]3c3nc4ccccc4o3)ncnc2c1 |
| InChI | InChI=1S/C20H17ClN4O/c21-13-8-9-14-16(11-13)22-12-23-19(14)25-10-4-3-6-17(25)20-24-15-5-1-2-7-18(15)26-20/h1-2,5,7-9,11-12,17H,3-4,6,10H2/t17-/m0/s1 |
| InChIKey | NLMZOSXNHBMLKP-KRWDZBQOSA-N |
| XLogP | 5.16 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |