C13H15BrN2O4 — CID 97249828
2-(2-bromo-4-nitrophenyl)-N-[(2R,3R)-2-methyloxolan-3-yl]acetamide (PubChem CID 97249828) has the molecular formula C13H15BrN2O4 and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenyl)-N-[(2R,3R)-2-methyloxolan-3-yl]acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenyl)-N-[(2R,3R)-2-methyloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 97249828 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-(2-bromo-4-nitrophenyl)-N-[(2R,3R)-2-methyloxolan-3-yl]acetamide |
| SMILES | C[C@H]1OCC[C@H]1NC(=O)Cc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H15BrN2O4/c1-8-12(4-5-20-8)15-13(17)6-9-2-3-10(16(18)19)7-11(9)14/h2-3,7-8,12H,4-6H2,1H3,(H,15,17)/t8-,12-/m1/s1 |
| InChIKey | UYGYPUSWZRHFTA-PRHODGIISA-N |
| XLogP | 2.19 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|