C18H21BrN4O2 — CID 97252682
(2R)-2-(4-bromophenyl)-2-[4-[(4S)-2-oxopiperidine-4-carbonyl]piperazin-1-yl]acetonitrile (PubChem CID 97252682) has the molecular formula C18H21BrN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-2-[4-[(4S)-2-oxopiperidine-4-carbonyl]piperazin-1-yl]acetonitrile.
| Compound Name | (2R)-2-(4-bromophenyl)-2-[4-[(4S)-2-oxopiperidine-4-carbonyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 97252682 |
| Molecular Formula | C18H21BrN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-2-[4-[(4S)-2-oxopiperidine-4-carbonyl]piperazin-1-yl]acetonitrile |
| SMILES | N#C[C@@H](c1ccc(Br)cc1)N1CCN(C(=O)[C@H]2CCNC(=O)C2)CC1 |
| InChI | InChI=1S/C18H21BrN4O2/c19-15-3-1-13(2-4-15)16(12-20)22-7-9-23(10-8-22)18(25)14-5-6-21-17(24)11-14/h1-4,14,16H,5-11H2,(H,21,24)/t14-,16-/m0/s1 |
| InChIKey | PBNZVJZVGOICED-HOCLYGCPSA-N |
| XLogP | 1.68 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |