About 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile
2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile (PubChem CID 97253290) has the molecular formula C14H17FN2O3S
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile |
| PubChem CID | 97253290 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile |
| SMILES | C[C@@H]1CC[C@H](CO)CN1S(=O)(=O)c1cccc(F)c1C#N |
| InChI | InChI=1S/C14H17FN2O3S/c1-10-5-6-11(9-18)8-17(10)21(19,20)14-4-2-3-13(15)12(14)7-16/h2-4,10-11,18H,5-6,8-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | IMIZBWHHVSNQRG-MNOVXSKESA-N |
| XLogP | 1.48 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile?
The IUPAC name of 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile (CID 97253290) is 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile.
What is the SMILES notation for 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile?
The canonical SMILES for 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile is C[C@@H]1CC[C@H](CO)CN1S(=O)(=O)c1cccc(F)c1C#N.
What is the InChIKey of 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile?
The InChIKey is IMIZBWHHVSNQRG-MNOVXSKESA-N. The full InChI is InChI=1S/C14H17FN2O3S/c1-10-5-6-11(9-18)8-17(10)21(19,20)14-4-2-3-13(15)12(14)7-16/h2-4,10-11,18H,5-6,8-9H2,1H3/t10-,11+/m1/s1.
What are the key properties of 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile?
2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile has a molecular weight of 312.37 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[(2R,5S)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]sulfonylbenzonitrile is sourced from PubChem (CID 97253290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).