C18H19Cl2N5O — CID 97255572
3-(3,5-dichlorophenyl)-N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 97255572) has the molecular formula C18H19Cl2N5O and a molecular weight of 392.29 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(3,5-dichlorophenyl)-N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 97255572 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | C[C@H]1C[C@H](CNc2ccc3nnc(-c4cc(Cl)cc(Cl)c4)n3n2)CCO1 |
| InChI | InChI=1S/C18H19Cl2N5O/c1-11-6-12(4-5-26-11)10-21-16-2-3-17-22-23-18(25(17)24-16)13-7-14(19)9-15(20)8-13/h2-3,7-9,11-12H,4-6,10H2,1H3,(H,21,24)/t11-,12+/m0/s1 |
| InChIKey | JAWIOMALASRWHI-NWDGAFQWSA-N |
| XLogP | 4.33 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |