C20H20F3NO5 — CID 97255894
benzyl (2S)-2-hydroxy-3-[3-[2-(trifluoromethoxy)phenyl]propanoylamino]propanoate (PubChem CID 97255894) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is benzyl (2S)-2-hydroxy-3-[3-[2-(trifluoromethoxy)phenyl]propanoylamino]propanoate.
| Compound Name | benzyl (2S)-2-hydroxy-3-[3-[2-(trifluoromethoxy)phenyl]propanoylamino]propanoate |
|---|---|
| PubChem CID | 97255894 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | benzyl (2S)-2-hydroxy-3-[3-[2-(trifluoromethoxy)phenyl]propanoylamino]propanoate |
| SMILES | O=C(CCc1ccccc1OC(F)(F)F)NC[C@H](O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H20F3NO5/c21-20(22,23)29-17-9-5-4-8-15(17)10-11-18(26)24-12-16(25)19(27)28-13-14-6-2-1-3-7-14/h1-9,16,25H,10-13H2,(H,24,26)/t16-/m0/s1 |
| InChIKey | MCQKKFIQMOQQHS-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |