C18H25N3O5S — CID 97257734
N'-[4-(cyclopropylsulfamoyl)phenyl]-N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]oxamide (PubChem CID 97257734) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N'-[4-(cyclopropylsulfamoyl)phenyl]-N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]oxamide.
| Compound Name | N'-[4-(cyclopropylsulfamoyl)phenyl]-N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]oxamide |
|---|---|
| PubChem CID | 97257734 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N'-[4-(cyclopropylsulfamoyl)phenyl]-N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]oxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CC2)cc1)C(=O)N[C@@H]1CCCC[C@@H]1CO |
| InChI | InChI=1S/C18H25N3O5S/c22-11-12-3-1-2-4-16(12)20-18(24)17(23)19-13-7-9-15(10-8-13)27(25,26)21-14-5-6-14/h7-10,12,14,16,21-22H,1-6,11H2,(H,19,23)(H,20,24)/t12-,16-/m1/s1 |
| InChIKey | BRUVMNDBELXQMG-MLGOLLRUSA-N |
| XLogP | 0.73 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|