About methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate
methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate (PubChem CID 97258147) has the molecular formula C16H18ClNO6S
and a molecular weight of 387.84 g/mol. Its IUPAC name is methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate |
| PubChem CID | 97258147 |
| Molecular Formula | C16H18ClNO6S |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N[C@@H](C)C[C@H](O)c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClNO6S/c1-10(8-13(19)14-4-3-7-24-14)18-25(21,22)15-6-5-11(9-12(15)17)16(20)23-2/h3-7,9-10,13,18-19H,8H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | YKJRZNPSVYBDDK-GWCFXTLKSA-N |
| XLogP | 2.51 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate?
The IUPAC name of methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate (CID 97258147) is methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate.
What is the SMILES notation for methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate?
The canonical SMILES for methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate is COC(=O)c1ccc(S(=O)(=O)N[C@@H](C)C[C@H](O)c2ccco2)c(Cl)c1.
What is the InChIKey of methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate?
The InChIKey is YKJRZNPSVYBDDK-GWCFXTLKSA-N. The full InChI is InChI=1S/C16H18ClNO6S/c1-10(8-13(19)14-4-3-7-24-14)18-25(21,22)15-6-5-11(9-12(15)17)16(20)23-2/h3-7,9-10,13,18-19H,8H2,1-2H3/t10-,13-/m0/s1.
What are the key properties of methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate?
methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate has a molecular weight of 387.84 g/mol, XLogP of 2.51, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-4-[[(2S,4S)-4-(furan-2-yl)-4-hydroxybutan-2-yl]sulfamoyl]benzoate is sourced from PubChem (CID 97258147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).