C22H35NO3 — CID 97258974
(2R)-2-(3-tert-butylphenoxy)-N-[[1-[(2S)-4-hydroxybutan-2-yl]cyclobutyl]methyl]propanamide (PubChem CID 97258974) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (2R)-2-(3-tert-butylphenoxy)-N-[[1-[(2S)-4-hydroxybutan-2-yl]cyclobutyl]methyl]propanamide.
| Compound Name | (2R)-2-(3-tert-butylphenoxy)-N-[[1-[(2S)-4-hydroxybutan-2-yl]cyclobutyl]methyl]propanamide |
|---|---|
| PubChem CID | 97258974 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (2R)-2-(3-tert-butylphenoxy)-N-[[1-[(2S)-4-hydroxybutan-2-yl]cyclobutyl]methyl]propanamide |
| SMILES | C[C@@H](Oc1cccc(C(C)(C)C)c1)C(=O)NCC1([C@@H](C)CCO)CCC1 |
| InChI | InChI=1S/C22H35NO3/c1-16(10-13-24)22(11-7-12-22)15-23-20(25)17(2)26-19-9-6-8-18(14-19)21(3,4)5/h6,8-9,14,16-17,24H,7,10-13,15H2,1-5H3,(H,23,25)/t16-,17+/m0/s1 |
| InChIKey | ZZLFDZQLMTVILV-DLBZAZTESA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |