About N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine
N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine (PubChem CID 97259591) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine.
Molecular Properties
| Compound Name | N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine |
| PubChem CID | 97259591 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine |
| SMILES | c1ccc2c(NC[C@H]3COC4(CCOCC4)O3)ccnc2c1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-4-15-14(3-1)16(5-8-18-15)19-11-13-12-21-17(22-13)6-9-20-10-7-17/h1-5,8,13H,6-7,9-12H2,(H,18,19)/t13-/m0/s1 |
| InChIKey | HOWWIDGQUQHAKO-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine?
The IUPAC name of N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine (CID 97259591) is N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine.
What is the SMILES notation for N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine?
The canonical SMILES for N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine is c1ccc2c(NC[C@H]3COC4(CCOCC4)O3)ccnc2c1.
What is the InChIKey of N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine?
The InChIKey is HOWWIDGQUQHAKO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-2-4-15-14(3-1)16(5-8-18-15)19-11-13-12-21-17(22-13)6-9-20-10-7-17/h1-5,8,13H,6-7,9-12H2,(H,18,19)/t13-/m0/s1.
What are the key properties of N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine?
N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine has a molecular weight of 300.36 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S)-1,4,8-trioxaspiro[4.5]decan-3-yl]methyl]quinolin-4-amine is sourced from PubChem (CID 97259591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).