C13H11N5S3 — CID 97260402
(6R)-3-pyridin-3-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 97260402) has the molecular formula C13H11N5S3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (6R)-3-pyridin-3-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | (6R)-3-pyridin-3-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 97260402 |
| Molecular Formula | C13H11N5S3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | (6R)-3-pyridin-3-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | c1cncc(-c2nnc3n2C[C@H](CSc2nccs2)S3)c1 |
| InChI | InChI=1S/C13H11N5S3/c1-2-9(6-14-3-1)11-16-17-12-18(11)7-10(21-12)8-20-13-15-4-5-19-13/h1-6,10H,7-8H2/t10-/m1/s1 |
| InChIKey | XKADCGLMYXWUMR-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|